4-(3-methylphenoxy)benzene-1,2-diamine structure
|
Common Name | 4-(3-methylphenoxy)benzene-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 43156-15-6 | Molecular Weight | 214.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-methylphenoxy)benzene-1,2-diamine |
|---|
| Molecular Formula | C13H14N2O |
|---|---|
| Molecular Weight | 214.26300 |
| Exact Mass | 214.11100 |
| PSA | 61.27000 |
| LogP | 4.11410 |
| InChIKey | YRPXGOAXCUIMLQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Oc2ccc(N)c(N)c2)c1 |
|
~%
4-(3-methylphen... CAS#:43156-15-6 |
| Literature: Cortes; Anaya Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 3 p. 745 - 748 |
|
~%
4-(3-methylphen... CAS#:43156-15-6 |
| Literature: Cortes; Anaya Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 3 p. 745 - 748 |
|
~%
4-(3-methylphen... CAS#:43156-15-6 |
| Literature: Cortes; Anaya Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 3 p. 745 - 748 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |