Sodium 2-oxo-2-phenylacetate structure
|
Common Name | Sodium 2-oxo-2-phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 43165-51-1 | Molecular Weight | 172.11 | |
| Density | N/A | Boiling Point | 258.6ºC at 760 mmHg | |
| Molecular Formula | C8H5NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.4ºC | |
Use of Sodium 2-oxo-2-phenylacetatePhenylglyoxylic acid (sodium) is the sodium salt form of Phenylglyoxylic acid. Phenylglyoxylic acid as a biomarker of exposure to ethylbenzene and styrene (EB/S)[1]. |
| Name | sodium,2-oxo-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Phenylglyoxylic acid (sodium) is the sodium salt form of Phenylglyoxylic acid. Phenylglyoxylic acid as a biomarker of exposure to ethylbenzene and styrene (EB/S)[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 258.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H5NaO3 |
| Molecular Weight | 172.11 |
| Flash Point | 124.4ºC |
| Exact Mass | 172.01400 |
| PSA | 57.20000 |
| InChIKey | GGDFZLZSWSCHFU-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(=O)c1ccccc1.[Na+] |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| phenyl-glyoxylic acid,sodium-compound |
| Benzeneacetic acid,a-oxo-,sodium salt |
| sodium salt of benzoylformic acid |
| sodium benzoyl formate |
| phenylglyoxylic acid sodium salt |
| Sodium phenylglyoxylate |
| sodium benzoylformiate |
| EINECS 256-125-8 |