N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]butan-1-amine structure
|
Common Name | N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 4319-69-1 | Molecular Weight | 340.67300 | |
| Density | 1.216g/cm3 | Boiling Point | 415.4ºC at 760 mmHg | |
| Molecular Formula | C14H20Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | N-[2-[2-(2,4,6-trichlorophenoxy)ethoxy]ethyl]butan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 415.4ºC at 760 mmHg |
| Molecular Formula | C14H20Cl3NO2 |
| Molecular Weight | 340.67300 |
| Flash Point | 205ºC |
| Exact Mass | 339.05600 |
| PSA | 30.49000 |
| LogP | 4.82280 |
| Index of Refraction | 1.521 |
| InChIKey | GVTWWOGMVHNPIJ-UHFFFAOYSA-N |
| SMILES | CCCCNCCOCCOc1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Benzyl-5-brom-4,6-dichlor pyrimidin |
| 2-benzyl-5-bromo-4,6-dichloro-pyrimidine |