2-(4-Nitrophenyl)-1,2-benzisothiazol-3(2h)-one
Modify Date: 2026-07-14 05:17:14
2-(4-Nitrophenyl)-1,2-benzisothiazol-3(2h)-one structure
|
Common Name | 2-(4-Nitrophenyl)-1,2-benzisothiazol-3(2h)-one | ||
|---|---|---|---|---|
| CAS Number | 4322-98-9 | Molecular Weight | 272.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Nitrophenyl)-1,2-benzisothiazol-3(2h)-one |
|---|
| Molecular Formula | C13H8N2O3S |
|---|---|
| Molecular Weight | 272.28 |
| InChIKey | TZTYWSXJWHDMBM-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2sn1-c1ccc([N+](=O)[O-])cc1 |
|
Name: Inhibition of DENV2 NS2B-NS3 protease at 50 uM using Bz-Nle-Lys-Arg-Arg-AMC as substr...
Source: ChEMBL
Target: Genome polyprotein
External Id: CHEMBL5109290
|
|
Name: Inhibition of DENV2 NS2B-NS3 protease using Bz-Nle-Lys-Arg-Arg-AMC as substrate by sp...
Source: ChEMBL
Target: Genome polyprotein
External Id: CHEMBL5109291
|
|
Name: In vitro ability to inhibit cartilage breakdown by using 1L-1beta stimulated bovine n...
Source: ChEMBL
Target: Bos taurus
External Id: CHEMBL653386
|
Total 3, Current Page 1 of 1
1