9H-Purine-9-heptanenitrile,1,6-dihydro-6-thioxo- structure
|
Common Name | 9H-Purine-9-heptanenitrile,1,6-dihydro-6-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 4323-17-5 | Molecular Weight | 261.34600 | |
| Density | 1.31g/cm3 | Boiling Point | 553ºC at 760mmHg | |
| Molecular Formula | C12H15N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.3ºC | |
| Name | 7-(6-sulfanylidene-3H-purin-9-yl)heptanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 553ºC at 760mmHg |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.34600 |
| Flash Point | 288.3ºC |
| Exact Mass | 261.10500 |
| PSA | 102.38000 |
| LogP | 2.96298 |
| Index of Refraction | 1.678 |
| InChIKey | VXACZARRCRNPNT-UHFFFAOYSA-N |
| SMILES | N#CCCCCCCn1cnc2c(=S)nc[nH]c21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Mercapto-9H-purin-9-yl-heptanonitril |
| 7-(6-thioxo-1,6-dihydro-purin-9-yl)-heptanenitrile |