N-(4-bromo-2-methylphenyl)-2-(4-propan-2-ylphenoxy)acetamide structure
|
Common Name | N-(4-bromo-2-methylphenyl)-2-(4-propan-2-ylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 432496-28-1 | Molecular Weight | 362.26100 | |
| Density | 1.324g/cm3 | Boiling Point | 497.1ºC at 760 mmHg | |
| Molecular Formula | C18H20BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | N-(4-bromo-2-methylphenyl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 497.1ºC at 760 mmHg |
| Molecular Formula | C18H20BrNO2 |
| Molecular Weight | 362.26100 |
| Flash Point | 254.4ºC |
| Exact Mass | 361.06800 |
| PSA | 38.33000 |
| LogP | 4.97140 |
| Index of Refraction | 1.599 |
| InChIKey | PTQIAMFFOFCBQH-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)ccc1NC(=O)COc1ccc(C(C)C)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-bromo-2-methylphenyl)-2-(4-isopropylphenoxy)acetamide |