N-(4-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenoxy)acetamide structure
|
Common Name | N-(4-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 432526-49-3 | Molecular Weight | 366.22500 | |
| Density | 1.401g/cm3 | Boiling Point | 490.2ºC at 760 mmHg | |
| Molecular Formula | C17H17BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.3ºC | |
| Name | N-(4-bromo-2-fluorophenyl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 490.2ºC at 760 mmHg |
| Molecular Formula | C17H17BrFNO2 |
| Molecular Weight | 366.22500 |
| Flash Point | 250.3ºC |
| Exact Mass | 365.04300 |
| PSA | 41.82000 |
| LogP | 5.37860 |
| Index of Refraction | 1.593 |
| InChIKey | SZRSJKXICOEKPG-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2ccc(Br)cc2F)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-bromo-2-fluorophenyl)-2-(4-isopropylphenoxy)acetamide |