dimethyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioate structure
|
Common Name | dimethyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 432545-60-3 | Molecular Weight | 482.49200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H26N8O5 |
|---|---|
| Molecular Weight | 482.49200 |
| Exact Mass | 482.20300 |
| PSA | 189.27000 |
| LogP | 1.34740 |
| InChIKey | DIQFVFAFHNQUTG-FIBGUPNXSA-N |
| SMILES | COC(=O)CCC(NC(=O)c1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)OC |
|
~%
dimethyl 2-[[4-... CAS#:432545-60-3 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 45, # 1 p. 29 - 36 |
|
~%
dimethyl 2-[[4-... CAS#:432545-60-3 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 45, # 1 p. 29 - 36 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethyl Methotrexate-d3 |
| Methotrexate-methyl-d3,Dimethyl Ester |
| Methotrexate-d3 Dimethyl Ester |