2,2,3,3-tetramethyl-1-(4-methylphenyl)sulfonylaziridine structure
|
Common Name | 2,2,3,3-tetramethyl-1-(4-methylphenyl)sulfonylaziridine | ||
|---|---|---|---|---|
| CAS Number | 432545-79-4 | Molecular Weight | 253.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3-tetramethyl-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19NO2S |
|---|---|
| Molecular Weight | 253.36000 |
| Exact Mass | 253.11400 |
| PSA | 45.53000 |
| LogP | 3.57520 |
| InChIKey | OGCWWGXVPOSGRT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C)(C)C2(C)C)cc1 |
|
~85%
2,2,3,3-tetrame... CAS#:432545-79-4 |
| Literature: Li, Yang; Diebl, Bernd; Raith, Alexander; Kuehn, Fritz E. Tetrahedron Letters, 2008 , vol. 49, # 41 p. 5954 - 5956 |
|
~%
2,2,3,3-tetrame... CAS#:432545-79-4 |
| Literature: Au, Sze-Man; Huang, Jie-Sheng; Yu, Wing-Yiu; Fung, Wai-Hong; Che, Chi-Ming Journal of the American Chemical Society, 1999 , vol. 121, # 39 p. 9120 - 9132 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2,3,3-tetramethyl-1-tosylaziridine |
| 2,2,3,3-tetramethyl-N-tosylaziridine |