1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene
Modify Date: 2025-09-04 15:35:11
![1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene Structure](https://image.chemsrc.com/caspic/042/4329-04-8.png)
1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene structure
|
Common Name | 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 4329-04-8 | Molecular Weight | 401.75400 | |
| Density | 1.201g/cm3 | Boiling Point | 484.4ºC at 760 mmHg | |
| Molecular Formula | C20H23Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.2ºC | |
| Name | 1-propoxy-4-[2,2,2-trichloro-1-(4-propoxyphenyl)ethyl]benzene |
|---|
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 484.4ºC at 760 mmHg |
| Molecular Formula | C20H23Cl3O2 |
| Molecular Weight | 401.75400 |
| Flash Point | 148.2ºC |
| Exact Mass | 400.07600 |
| PSA | 18.46000 |
| LogP | 6.76630 |
| Index of Refraction | 1.55 |
| InChIKey | MXJPGMXPKMPPGD-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(C(c2ccc(OCCC)cc2)C(Cl)(Cl)Cl)cc1 |
| HS Code | 2909309090 |
|---|
|
~%
1-propoxy-4-[2,... CAS#:4329-04-8 |
| Literature: Stephenson; Waters Journal of the Chemical Society, 1946 , p. 339,342 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |