17-acetyl-6-fluoro-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one structure
|
Common Name | 17-acetyl-6-fluoro-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | ||
|---|---|---|---|---|
| CAS Number | 433-85-2 | Molecular Weight | 348.45200 | |
| Density | 1.19g/cm3 | Boiling Point | 489.4ºC at 760 mmHg | |
| Molecular Formula | C21H29FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.8ºC | |
| Name | 17-acetyl-6-fluoro-11-hydroxy-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 489.4ºC at 760 mmHg |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.45200 |
| Flash Point | 249.8ºC |
| Exact Mass | 348.21000 |
| PSA | 54.37000 |
| LogP | 3.64230 |
| Vapour Pressure | 1.24E-11mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | WKLSIBAACVYLOP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CCC2C3CC(F)C4=CC(=O)CCC4(C)C3C(O)CC12C |
|
~%
17-acetyl-6-flu... CAS#:433-85-2 |
| Literature: Upjohn Co. Patent: US2838501 , 1957 ; |
|
~%
17-acetyl-6-flu... CAS#:433-85-2 |
| Literature: Upjohn Co. Patent: US2838501 , 1957 ; |
|
~%
17-acetyl-6-flu... CAS#:433-85-2 |
| Literature: Upjohn Co. Patent: US2838501 , 1957 ; |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 6-a-Fluor-Hydrocortisone |