3-bromo-5-methoxy-4-(pyridin-2-ylmethoxy)benzaldehyde
Modify Date: 2025-10-15 18:04:53
3-bromo-5-methoxy-4-(pyridin-2-ylmethoxy)benzaldehyde structure
|
Common Name | 3-bromo-5-methoxy-4-(pyridin-2-ylmethoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 433330-10-0 | Molecular Weight | 322.15400 | |
| Density | 1.469g/cm3 | Boiling Point | 435.5ºC at 760 mmHg | |
| Molecular Formula | C14H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.2ºC | |
| Name | 3-bromo-5-methoxy-4-(pyridin-2-ylmethoxy)benzaldehyde |
|---|
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 435.5ºC at 760 mmHg |
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.15400 |
| Flash Point | 217.2ºC |
| Exact Mass | 321.00000 |
| PSA | 48.42000 |
| LogP | 3.24420 |
| Index of Refraction | 1.616 |
| InChIKey | XGTQGYDYRLIVJR-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(Br)c1OCc1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |