bis(3-chlorophenyl)borinic acid structure
|
Common Name | bis(3-chlorophenyl)borinic acid | ||
|---|---|---|---|---|
| CAS Number | 433338-06-8 | Molecular Weight | 250.91600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BCl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(3-chlorophenyl)borinic acid |
|---|
| Molecular Formula | C12H9BCl2O |
|---|---|
| Molecular Weight | 250.91600 |
| Exact Mass | 250.01200 |
| PSA | 20.23000 |
| LogP | 2.09140 |