4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol structure
|
Common Name | 4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 433719-69-8 | Molecular Weight | 286.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10F4O2 |
|---|---|
| Molecular Weight | 286.22200 |
| Exact Mass | 286.06200 |
| PSA | 40.46000 |
| LogP | 3.98160 |
| InChIKey | YFWMKHJNNZCGHF-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C(F)(F)C(F)(F)c2ccc(O)cc2)cc1 |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| pc2221 |