(2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone structure
|
Common Name | (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone | ||
|---|---|---|---|---|
| CAS Number | 4339-69-9 | Molecular Weight | 205.16700 | |
| Density | 1.37g/cm3 | Boiling Point | 341.4ºC at 760 mmHg | |
| Molecular Formula | C10H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 341.4ºC at 760 mmHg |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.16700 |
| Flash Point | 160.2ºC |
| Exact Mass | 205.03800 |
| PSA | 75.94000 |
| LogP | 1.93380 |
| Index of Refraction | 1.602 |
| InChIKey | RSLKNHHWFJLREX-PKNBQFBNSA-N |
| SMILES | O=C(C(=NO)c1ccco1)c1ccco1 |
|
~%
(2E)-1,2-bis(fu... CAS#:4339-69-9 |
| Literature: Martinek; Hovorka Collection of Czechoslovak Chemical Communications, 1957 , vol. 22, p. 246,247, 249 Anm. |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Furan,2,2'-oxalyldi-,oxime |
| 2-furilmonoxime |
| FURIL,MONOOXIME |
| di-furan-2-yl-ethanedione mono-oxime |
| Ethanedione,di-2-furanyl-,monooxime |
| Glyoxal,di-2-furyl-,monoxime |
| Furil,oxime |