2-Butanol,1,1,1-trifluoro-3-nitro- structure
|
Common Name | 2-Butanol,1,1,1-trifluoro-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 434-39-9 | Molecular Weight | 173.09100 | |
| Density | 1.418g/cm3 | Boiling Point | 222.8ºC at 760mmHg | |
| Molecular Formula | C4H6F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.5ºC | |
| Name | 1,1,1-trifluoro-3-nitrobutan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 222.8ºC at 760mmHg |
| Molecular Formula | C4H6F3NO3 |
| Molecular Weight | 173.09100 |
| Flash Point | 88.5ºC |
| Exact Mass | 173.03000 |
| PSA | 66.05000 |
| LogP | 1.09800 |
| Vapour Pressure | 0.0204mmHg at 25°C |
| Index of Refraction | 1.383 |
| InChIKey | PKQGAGPKSOAOPY-UHFFFAOYSA-N |
| SMILES | CC(C(O)C(F)(F)F)[N+](=O)[O-] |
| HS Code | 2905590090 |
|---|
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,1-trifluoro-3-nitro-butan-2-ol |
| 3-nitro-1,1,1-trifluoro-2-butanol |
| 3-nitro-1,1,1-trifluorobutan-2-ol |
| 1,1,1-Trifluor-3-nitro-butan-2-ol |