3-[(5-nitro-2-furyl)methylideneamino]-1,3-oxazinan-2-one structure
|
Common Name | 3-[(5-nitro-2-furyl)methylideneamino]-1,3-oxazinan-2-one | ||
|---|---|---|---|---|
| CAS Number | 4341-15-5 | Molecular Weight | 239.18500 | |
| Density | 1.57g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C9H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazinan-2-one |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.18500 |
| Flash Point | 175.3ºC |
| Exact Mass | 239.05400 |
| PSA | 100.86000 |
| LogP | 1.82510 |
| Index of Refraction | 1.648 |
| InChIKey | NOZLWTTVYNQLNJ-UXBLZVDNSA-N |
| SMILES | O=C1OCCCN1N=Cc1ccc([N+](=O)[O-])o1 |
|
~%
3-[(5-nitro-2-f... CAS#:4341-15-5 |
| Literature: Hayes Journal of the American Chemical Society, 1955 , vol. 77, p. 2333 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |