N-(3,4-dimethylphenyl)-2-propylpentanamide structure
|
Common Name | N-(3,4-dimethylphenyl)-2-propylpentanamide | ||
|---|---|---|---|---|
| CAS Number | 4344-69-8 | Molecular Weight | 247.37600 | |
| Density | 0.972g/cm3 | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | N-(3,4-dimethylphenyl)-2-propylpentanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.972g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760 mmHg |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.37600 |
| Flash Point | 239.1ºC |
| Exact Mass | 247.19400 |
| PSA | 29.10000 |
| LogP | 4.53130 |
| Index of Refraction | 1.524 |
| InChIKey | VGKUCVZNGRQCMK-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)C(=O)Nc1ccc(C)c(C)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(3,4-dimethyl... CAS#:4344-69-8 |
| Literature: Benoit-Guyod,J.-L. et al. Bulletin de la Societe Chimique de France, 1965 , p. 1660 - 1661 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Propyl-valeriansaeure-<3,4-dimethyl-anilid> |
| 2-Propyl-3',4'-valeroxylidide |
| 3',4'-Valeroxylidide,2-propyl |