Rhamnolipid RL2
Rhamnolipid RL2 structure
|
Common Name | Rhamnolipid RL2 | ||
|---|---|---|---|---|
| CAS Number | 4348-76-9 | Molecular Weight | 650.79500 | |
| Density | 1.23g/cm3 | Boiling Point | 798.8ºC at 760mmHg | |
| Molecular Formula | C32H58O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
Use of Rhamnolipid RL2Rhamnolipid RL2, is a rhamnolipid, shows antifungal activity[1][2]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Rhamnolipid RL2, is a rhamnolipid, shows antifungal activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 798.8ºC at 760mmHg |
| Molecular Formula | C32H58O13 |
| Molecular Weight | 650.79500 |
| Flash Point | 243.4ºC |
| Exact Mass | 650.38800 |
| PSA | 201.67000 |
| LogP | 2.54850 |
| Index of Refraction | 1.533 |
| InChIKey | FCBUKWWQSZQDDI-SESCQDRSSA-N |
| SMILES | CCCCCCCC(CC(=O)O)OC(=O)CC(CCCCCCC)OC1OC(C)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Rhamnolipid R 1 |
| Glycolipid B |
| Rhamnolipid 2 |
| Rhamnolipid R-1 |
| 2-O-alpha-L-rhamnosyl-alpha-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid |
| 2-O-rhamnopyranosyl-rhamnopyranosyl-3-hydroxyldecanoyl-3-hydroxydecanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: Molecular weight of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is 650.79500. |
| Q: What is the SMILES notation of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: SMILES notation of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is CCCCCCCC(CC(=O)O)OC(=O)CC(CCCCCCC)OC1OC(C)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O. |
| Q: What is the molecular formula of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: Molecular formula of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is C32H58O13. |
| Q: What is the polar surface area (PSA) of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: Polar surface area (PSA) of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is 201.67000. |
| Q: What is the InChIKey of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: InChIKey of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is FCBUKWWQSZQDDI-SESCQDRSSA-N. |
| Q: What is the boiling point of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: Boiling point of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is 798.8ºC at 760mmHg. |
| Q: What is the Chinese name of 4348-76-9? |
| A: Chinese name of 4348-76-9 is Rhamnolipid RL2. |
| Q: What is the English name of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: The English name of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid. |
| Q: What is the LogP of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: LogP of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid is 2.54850. |
| Q: What are the uses of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid? |
| A: Main uses of 2-O-α-L-rhamnosyl-α-L-rhamnosyl-3-hydroxydecanoyl-3-hydroxydecanoic acid: Rhamnolipid RL2, is a rhamnolipid, shows antifungal activity[1][2]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |