N-(2-amino-4-methoxyphenyl)-2-methylpropanamide
Modify Date: 2025-09-13 12:12:14
N-(2-amino-4-methoxyphenyl)-2-methylpropanamide structure
|
Common Name | N-(2-amino-4-methoxyphenyl)-2-methylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 436090-31-2 | Molecular Weight | 208.25700 | |
| Density | 1.143g/cm3 | Boiling Point | 409ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | N-(2-amino-4-methoxyphenyl)-2-methylpropanamide |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 409ºC at 760 mmHg |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.25700 |
| Flash Point | 201.2ºC |
| Exact Mass | 208.12100 |
| PSA | 64.35000 |
| LogP | 2.52610 |
| Index of Refraction | 1.58 |
| InChIKey | ALBPLOCZDLKOSA-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)C(C)C)c(N)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |