7-butyl-1,3-dimethyl-8-sulfanylidene-9H-purine-2,6-dione structure
|
Common Name | 7-butyl-1,3-dimethyl-8-sulfanylidene-9H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 436094-92-7 | Molecular Weight | 268.33500 | |
| Density | 1.39g/cm3 | Boiling Point | 346.3ºC at 760mmHg | |
| Molecular Formula | C11H16N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | 7-butyl-1,3-dimethyl-8-sulfanylidene-9H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 346.3ºC at 760mmHg |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.33500 |
| Flash Point | 163.2ºC |
| Exact Mass | 268.09900 |
| PSA | 100.62000 |
| LogP | 0.52250 |
| Index of Refraction | 1.658 |
| InChIKey | KACXGTLTRSDZAJ-UHFFFAOYSA-N |
| SMILES | CCCCn1c(=S)[nH]c2c1c(=O)n(C)c(=O)n2C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Butyl-8-mercapto-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 7-butyl-1,3-dimethyl-8-sulfanyl-3,7-dihydro-1H-purine-2,6-dione |