2-[(4-hydroxy-3-methoxyphenyl)-phenylmethyl]benzoic acid
Modify Date: 2025-09-02 13:15:28
![2-[(4-hydroxy-3-methoxyphenyl)-phenylmethyl]benzoic acid Structure](https://image.chemsrc.com/caspic/272/4366-05-6.png)
2-[(4-hydroxy-3-methoxyphenyl)-phenylmethyl]benzoic acid structure
|
Common Name | 2-[(4-hydroxy-3-methoxyphenyl)-phenylmethyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4366-05-6 | Molecular Weight | 334.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-hydroxy-3-methoxyphenyl)-phenylmethyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18O4 |
|---|---|
| Molecular Weight | 334.36500 |
| Exact Mass | 334.12100 |
| PSA | 66.76000 |
| LogP | 4.27920 |
| InChIKey | URQQYOANYMHWHM-UHFFFAOYSA-N |
| SMILES | COc1cc(C(c2ccccc2)c2ccccc2C(=O)O)ccc1O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-<4'-Hydroxy-3'-methoxy-benzhydryl>-benzoesaeure |