Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]
Modify Date: 2026-08-07 20:12:04
![Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] Structure](https://www.chemsrc.com/extcaspic/089/4366-90-9.png)
Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] structure
|
Common Name | Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 4366-90-9 | Molecular Weight | 296.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11Cl2NO2 |
|---|---|
| Molecular Weight | 296.1 |
| InChIKey | LNDMBLZYNFDIQZ-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc(Cl)c1Nc1ccccc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]? |
| A: SMILES notation of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] is Cc1c(Cl)ccc(Cl)c1Nc1ccccc1C(=O)O. |
| Q: What is the molecular formula of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]? |
| A: Molecular formula of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] is C14H11Cl2NO2. |
| Q: What is the Chinese name of 4366-90-9? |
| A: Chinese name of 4366-90-9 is 4366-90-9. |
| Q: What is the English name of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]? |
| A: The English name of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] is Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]. |
| Q: What is the molecular weight of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]? |
| A: Molecular weight of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] is 296.1. |
| Q: What is the InChIKey of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]? |
| A: InChIKey of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] is LNDMBLZYNFDIQZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino]? |
| A: CAS number of Benzoic acid,2-[(3,6-dichloro-2-methylphenyl)amino] is 4366-90-9. |