2-(3,5-Dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-methylbutanoic acid structure
|
Common Name | 2-(3,5-Dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 436811-19-7 | Molecular Weight | 289.32600 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 517.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7±30.1 °C | |
| Name | 2-(3,5-Dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.4±50.0 °C at 760 mmHg |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.32600 |
| Flash Point | 266.7±30.1 °C |
| Exact Mass | 289.13100 |
| PSA | 74.68000 |
| LogP | 1.59 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | ABNVHVKLRCQXOW-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3C=CC(C4CC34)C2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,6-Ethenocycloprop[f]isoindole-2(1H)-acetic acid, 3,3a,4,4a,5,5a,6,6a-octahydro-α-(1-methylethyl)-1,3-dioxo- |
| 2-(3,5-dioxo-4-azatetracyclo[5.3.2.0 |
| 2-(1,3-dioxooctahydro-4,6-ethenocyclopropa[f]isoindol-2(1H)-yl)-3-methylbutanoic acid |
| 2-(3,5-Dioxo-4-azatetracyclo[5.3.2.0.0]dodec-11-en-4-yl)-3-methylbutanoic acid |
| 2-(3,5-DIOXO-4-AZATETRACYCLO[5.3.2.0(2,6).0(8,10)]DODEC-11-EN-4-YL)-3-METHYLBUTANOIC ACID |