Gliorosein structure
|
Common Name | Gliorosein | ||
|---|---|---|---|---|
| CAS Number | 4373-40-4 | Molecular Weight | 198.216 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 329.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.7±27.9 °C | |
Use of GlioroseinGliorosein is a fungal metabolite isolated from Gliocladium. Gliorosein is isomeric with the quinol but shows a different ultraviolet absorption spectrum[1]. |
| Name | Gliorosein |
|---|---|
| Synonym | More Synonyms |
| Description | Gliorosein is a fungal metabolite isolated from Gliocladium. Gliorosein is isomeric with the quinol but shows a different ultraviolet absorption spectrum[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. E.B. VISCHER. The structures of aurantio- and rubro-gliocladin and gliorosein. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.1±42.0 °C at 760 mmHg |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.216 |
| Flash Point | 145.7±27.9 °C |
| Exact Mass | 198.089203 |
| LogP | -0.61 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | OTGRRZBXIQUVOS-WDSKDSINSA-N |
| SMILES | COC1=C(OC)C(=O)C(C)C(C)C1=O |
| (5S,6S)-2,3-Dimethoxy-5,6-dimethyl-2-cyclohexene-1,4-dione |
| Gliorosein |
| 2-Cyclohexene-1,4-dione, 2,3-dimethoxy-5,6-dimethyl-, (5S,6S)- |