4-(Pyridin-3-yloxy)benzoic acid structure
|
Common Name | 4-(Pyridin-3-yloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 437383-99-8 | Molecular Weight | 215.205 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 391.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.4±22.3 °C | |
| Name | 4-(Pyridin-3-yloxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.2±22.0 °C at 760 mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.205 |
| Flash Point | 190.4±22.3 °C |
| Exact Mass | 215.058243 |
| PSA | 59.42000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | JZHQITAPTQQMIF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Oc2cccnc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~53%
4-(Pyridin-3-yl... CAS#:437383-99-8 |
| Literature: EP1348698 A1, ; Page/Page column 28 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3-Pyridinyloxy)benzoic acid |
| 4-pyridin-3-yloxybenzoic acid |
| Benzoic acid, 4-(3-pyridinyloxy)- |
| 4-(pyridin-3-yloxy)benzoic acid |