(2-benzoylphenyl)-[3-(trifluoromethyl)phenyl]methanone
Modify Date: 2026-07-27 17:31:03
![(2-benzoylphenyl)-[3-(trifluoromethyl)phenyl]methanone Structure](https://image.chemsrc.com/caspic/042/438-73-3.png)
(2-benzoylphenyl)-[3-(trifluoromethyl)phenyl]methanone structure
|
Common Name | (2-benzoylphenyl)-[3-(trifluoromethyl)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 438-73-3 | Molecular Weight | 354.32200 | |
| Density | 1.269g/cm3 | Boiling Point | 491.4ºC at 760 mmHg | |
| Molecular Formula | C21H13F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.8ºC | |
| Name | phenyl-[2-[3-(trifluoromethyl)benzoyl]phenyl]methanone |
|---|
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 491.4ºC at 760 mmHg |
| Molecular Formula | C21H13F3O2 |
| Molecular Weight | 354.32200 |
| Flash Point | 176.8ºC |
| Exact Mass | 354.08700 |
| PSA | 34.14000 |
| LogP | 5.16740 |
| Vapour Pressure | 8.44E-10mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | PHOAMUYJMADWML-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccccc1C(=O)c1cccc(C(F)(F)F)c1 |
|
~%
(2-benzoylpheny... CAS#:438-73-3 |
| Literature: Vingiello; Van Oot Journal of the American Chemical Society, 1951 , vol. 73, p. 5070 |
![Phenyl[2-[[3-(trifluoromethyl)phenyl]methyl]phenyl]methanone structure](https://www.chemsrc.com/extcaspic/101/390-29-4.png)