3-(4-methoxyphenyl)hexane-1,2,6-tricarboxylic acid structure
|
Common Name | 3-(4-methoxyphenyl)hexane-1,2,6-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4381-24-2 | Molecular Weight | 324.32600 | |
| Density | 1.314g/cm3 | Boiling Point | 509.5ºC at 760 mmHg | |
| Molecular Formula | C16H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | 3-(4-methoxyphenyl)hexane-1,2,6-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 509.5ºC at 760 mmHg |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.32600 |
| Flash Point | 184.1ºC |
| Exact Mass | 324.12100 |
| PSA | 121.13000 |
| LogP | 2.20920 |
| Index of Refraction | 1.557 |
| InChIKey | KENRMDZSAPYXPD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CCCC(=O)O)C(CC(=O)O)C(=O)O)cc1 |
|
~%
3-(4-methoxyphe... CAS#:4381-24-2 |
| Literature: Johnson et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 2395,2400 |
|
~%
3-(4-methoxyphe... CAS#:4381-24-2 |
| Literature: Johnson et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 2395,2400 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(4-Methoxy-phenyl)-hexan-1,2,6-tricarbonsaeure |
| 3-(4-methoxy-phenyl)-hexane-1,2,6-tricarboxylic acid |
| racem.-3-Carboxy-4-<4-methoxy-phenyl>-octan-1,8-disaeure |