N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide structure
|
Common Name | N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 438481-06-2 | Molecular Weight | 373.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20ClN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide |
|---|
| Molecular Formula | C15H20ClN3O4S |
|---|---|
| Molecular Weight | 373.9 |
| InChIKey | RWDTUIPBSYGQJR-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC=C(C=C2)Cl)NC(=O)N3CCOCC3 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Compound was evaluated for the inhibition of Trypanosoma cruzi LAP (at 30 µM)
Source: ChEMBL
Target: Aminopeptidase
External Id: CHEMBL5305022
|