2-methyl-4-(3-nitrophenyl)pyridine
2-methyl-4-(3-nitrophenyl)pyridine structure
|
Common Name | 2-methyl-4-(3-nitrophenyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 4385-82-4 | Molecular Weight | 214.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-4-(3-nitrophenyl)pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2O2 |
|---|---|
| Molecular Weight | 214.22000 |
| Exact Mass | 214.07400 |
| PSA | 58.71000 |
| LogP | 3.48840 |
| InChIKey | DWWATEVVFBMVDA-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cccc([N+](=O)[O-])c2)ccn1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: Molecular weight of 2-methyl-4-(3-nitrophenyl)pyridine is 214.22000. |
| Q: What is the CAS number of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: CAS number of 2-methyl-4-(3-nitrophenyl)pyridine is 4385-82-4. |
| Q: What is the polar surface area (PSA) of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: Polar surface area (PSA) of 2-methyl-4-(3-nitrophenyl)pyridine is 58.71000. |
| Q: What is the Chinese name of 4385-82-4? |
| A: Chinese name of 4385-82-4 is 4385-82-4. |
| Q: What are the upstream materials of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: Related upstream materials(CAS) of 2-methyl-4-(3-nitrophenyl)pyridine: 40034-60-4;21881-77-6;99-61-6;88434-68-8;76258-20-3. |
| Q: What is the molecular formula of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: Molecular formula of 2-methyl-4-(3-nitrophenyl)pyridine is C12H10N2O2. |
| Q: What is the English name of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: The English name of 2-methyl-4-(3-nitrophenyl)pyridine is 2-methyl-4-(3-nitrophenyl)pyridine. |
| Q: What is the LogP of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: LogP of 2-methyl-4-(3-nitrophenyl)pyridine is 3.48840. |
| Q: What is the SMILES notation of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: SMILES notation of 2-methyl-4-(3-nitrophenyl)pyridine is Cc1cc(-c2cccc([N+](=O)[O-])c2)ccn1. |
| Q: What is the InChIKey of 2-methyl-4-(3-nitrophenyl)pyridine? |
| A: InChIKey of 2-methyl-4-(3-nitrophenyl)pyridine is DWWATEVVFBMVDA-UHFFFAOYSA-N. |