Methyl 3-(4-formyl-2-nitrophenoxy)benzoate
Modify Date: 2025-09-18 20:31:02
Methyl 3-(4-formyl-2-nitrophenoxy)benzoate structure
|
Common Name | Methyl 3-(4-formyl-2-nitrophenoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 439095-08-6 | Molecular Weight | 301.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-(4-formyl-2-nitrophenoxy)benzoate |
|---|
| Molecular Formula | C15H11NO6 |
|---|---|
| Molecular Weight | 301.25100 |
| Exact Mass | 301.05900 |
| PSA | 98.42000 |
| LogP | 3.50940 |
| InChIKey | DRKPDPYIKLBLRR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(Oc2ccc(C=O)cc2[N+](=O)[O-])c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |