Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate structure
|
Common Name | Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 439095-52-0 | Molecular Weight | 248.321 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 410.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | 40-42ºC | |
| MSDS | N/A | Flash Point | 202.2±27.3 °C | |
| Name | ethyl 1-(4-aminophenyl)piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 410.7±40.0 °C at 760 mmHg |
| Melting Point | 40-42ºC |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.321 |
| Flash Point | 202.2±27.3 °C |
| Exact Mass | 248.152481 |
| PSA | 55.56000 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | JXCDVJXPSHIHLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(c2ccc(N)cc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
Ethyl 1-(4-amin... CAS#:439095-52-0 |
| Literature: WO2009/29998 A1, ; Page/Page column 58-59 ; WO 2009/029998 A1 |
|
~%
Ethyl 1-(4-amin... CAS#:439095-52-0 |
| Literature: MedChemComm, , vol. 5, # 2 p. 197 - 202 |
|
~%
Ethyl 1-(4-amin... CAS#:439095-52-0 |
| Literature: MedChemComm, , vol. 5, # 2 p. 197 - 202 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-ethoxycarbonylpiperidino)aniline |
| 4-Piperidinecarboxylic acid, 1-(4-aminophenyl)-, ethyl ester |
| WT695 |
| 1-(4-amino-phenyl)-piperidine-4-carboxylic acid ethyl ester |
| Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate |