(S)-2-Amino-5-methoxytetralin (S)-mandelate structure
|
Common Name | (S)-2-Amino-5-methoxytetralin (S)-mandelate | ||
|---|---|---|---|---|
| CAS Number | 439133-67-2 | Molecular Weight | 329.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-hydroxy-2-phenylacetic acid,(2S)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H23NO4 |
|---|---|
| Molecular Weight | 329.39000 |
| Exact Mass | 329.16300 |
| PSA | 92.78000 |
| LogP | 3.01610 |
| InChIKey | GTWGCLZVABLEAP-ANNIYNITSA-N |
| SMILES | COc1cccc2c1CCC(N)C2.O=C(O)C(O)c1ccccc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-5-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine (S)-2-hydroxy-2-phenylacetate |
| (S)-2-Amino-5-methoxytetralin (S)-mandelate |