2-Methyl-N1-(4-nitrophenyl)-1,2-propanediamine structure
|
Common Name | 2-Methyl-N1-(4-nitrophenyl)-1,2-propanediamine | ||
|---|---|---|---|---|
| CAS Number | 440102-93-2 | Molecular Weight | 209.24500 | |
| Density | 1.202g/cm3 | Boiling Point | 374.5ºC at 760 mmHg | |
| Molecular Formula | C10H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.3ºC | |
| Name | 2-Methyl-N1-(4-nitrophenyl)-1,2-propanediamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 374.5ºC at 760 mmHg |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.24500 |
| Flash Point | 180.3ºC |
| Exact Mass | 209.11600 |
| PSA | 83.87000 |
| LogP | 3.04050 |
| Index of Refraction | 1.603 |
| InChIKey | NPXCOEWUIDRQCC-UHFFFAOYSA-N |
| SMILES | CC(C)(N)CNc1ccc([N+](=O)[O-])cc1 |
|
~99%
2-Methyl-N1-(4-... CAS#:440102-93-2 |
| Literature: KYOWA HAKKO KOGYO CO., LTD. Patent: EP1354882 A1, 2003 ; Location in patent: Page/Page column 84 ; |
|
~88%
2-Methyl-N1-(4-... CAS#:440102-93-2 |
| Literature: Hoeglund, Iisa P. J.; Silver, Satu; Engstroem, Mia T.; Salo, Harri; Tauber, Andrei; Kyyroenen, Hanna-Kaisa; Saarenketo, Pauli; Hoffren, Anna-Marja; Kokko, Kurt; Pohjanoksa, Katariina; Sallinen, Jukka; Savola, Juha-Matti; Wurster, Siegfried; Kallatsa, Oili A. Journal of Medicinal Chemistry, 2006 , vol. 49, # 21 p. 6351 - 6363 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| caccure 907 |