(4S)-6-Chloro-4-[(E)-2-cyclopropylvinyl]-4-(trifluoromethyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one structure
|
Common Name | (4S)-6-Chloro-4-[(E)-2-cyclopropylvinyl]-4-(trifluoromethyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 440124-96-9 | Molecular Weight | 317.691 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 322.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H11ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5±27.9 °C | |
| Name | (4S)-6-Chloro-4-[(E)-2-cyclopropylvinyl]-4-(trifluoromethyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.0±42.0 °C at 760 mmHg |
| Molecular Formula | C14H11ClF3NO2 |
| Molecular Weight | 317.691 |
| Flash Point | 148.5±27.9 °C |
| Exact Mass | 317.043030 |
| LogP | 5.13 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | TWWHVRKXRMMRPN-GFUIURDCSA-N |
| SMILES | O=C1Nc2ccc(Cl)cc2C(C=CC2CC2)(C(F)(F)F)O1 |
| RIDADR | NONH for all modes of transport |
|---|
| 2H-3,1-Benzoxazin-2-one, 6-chloro-4-[(E)-2-cyclopropylethenyl]-1,4-dihydro-4-(trifluoromethyl)-, (4S)- |
| (4S)-6-Chloro-4-[(E)-2-cyclopropylvinyl]-4-(trifluoromethyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one |
| (4S)-6-Chloro-4-[(1E)-2-cyclopropylethenyl]-1,4-dihydro-4-(trifluoromethyl)-2H-3,1-benzoxazin-2-one |
| SR 695 |