2-(N-((2-carboxyphenyl)carbonylamino)carbamoyl)benzoic acid structure
|
Common Name | 2-(N-((2-carboxyphenyl)carbonylamino)carbamoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4404-90-4 | Molecular Weight | 328.27600 | |
| Density | 1.471g/cm3 | Boiling Point | 717.7ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 387.8ºC | |
| Name | 2-[[(2-carboxybenzoyl)amino]carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 717.7ºC at 760 mmHg |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.27600 |
| Flash Point | 387.8ºC |
| Exact Mass | 328.07000 |
| PSA | 132.80000 |
| LogP | 1.93960 |
| Index of Refraction | 1.659 |
| InChIKey | HEKGZWWZBBQCOB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)NNC(=O)c1ccccc1C(=O)O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ghl.PD_Mitscher_leg0.910 |