1-(2,3-dimethylindol-1-yl)-3-(3,5-dimethylpyrazol-1-yl)propan-2-ol structure
|
Common Name | 1-(2,3-dimethylindol-1-yl)-3-(3,5-dimethylpyrazol-1-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 441314-01-8 | Molecular Weight | 297.39500 | |
| Density | 1.15g/cm3 | Boiling Point | 505.1ºC at 760 mmHg | |
| Molecular Formula | C18H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.3ºC | |
| Name | 1-(2,3-dimethylindol-1-yl)-3-(3,5-dimethylpyrazol-1-yl)propan-2-ol |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 505.1ºC at 760 mmHg |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.39500 |
| Flash Point | 259.3ºC |
| Exact Mass | 297.18400 |
| PSA | 42.98000 |
| LogP | 3.13250 |
| Index of Refraction | 1.608 |
| InChIKey | ZHZAKMREZSLKFF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(CC(O)Cn2c(C)c(C)c3ccccc32)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |