5-(2-chlorophenyl)-2-methylfuran-3-carboxylic acid
Modify Date: 2025-08-25 18:06:37
5-(2-chlorophenyl)-2-methylfuran-3-carboxylic acid structure
|
Common Name | 5-(2-chlorophenyl)-2-methylfuran-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4414-49-7 | Molecular Weight | 236.65100 | |
| Density | 1.327g/cm3 | Boiling Point | 367.6ºC at 760 mmHg | |
| Molecular Formula | C12H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
| Name | 5-(2-chlorophenyl)-2-methylfuran-3-carboxylic acid |
|---|
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 367.6ºC at 760 mmHg |
| Molecular Formula | C12H9ClO3 |
| Molecular Weight | 236.65100 |
| Flash Point | 176.1ºC |
| Exact Mass | 236.02400 |
| PSA | 50.44000 |
| LogP | 3.60660 |
| Index of Refraction | 1.585 |
| InChIKey | KJXIJANIURSGHF-UHFFFAOYSA-N |
| SMILES | Cc1oc(-c2ccccc2Cl)cc1C(=O)O |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |