2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (Z)-3-naphthalen-1-ylprop-2-enoate structure
|
Common Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (Z)-3-naphthalen-1-ylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 4415-58-1 | Molecular Weight | 420.93100 | |
| Density | 1.231g/cm3 | Boiling Point | 606.5ºC at 760 mmHg | |
| Molecular Formula | C25H25ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.6ºC | |
| Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (Z)-3-naphthalen-1-ylprop-2-enoate |
|---|
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 606.5ºC at 760 mmHg |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.93100 |
| Flash Point | 320.6ºC |
| Exact Mass | 420.16000 |
| PSA | 32.78000 |
| LogP | 4.87470 |
| Index of Refraction | 1.645 |
| InChIKey | YEBWTDNXAXPGOD-JYRVWZFOSA-N |
| SMILES | O=C(C=Cc1cccc2ccccc12)OCCN1CCN(c2ccc(Cl)cc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |