1-(2-methoxyphenoxy)sulfonyl-4-methyl-benzene structure
|
Common Name | 1-(2-methoxyphenoxy)sulfonyl-4-methyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 4416-67-5 | Molecular Weight | 278.32400 | |
| Density | 1.245g/cm3 | Boiling Point | 427ºC at 760 mmHg | |
| Molecular Formula | C14H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212ºC | |
| Name | 2-chloro-1-propanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 427ºC at 760 mmHg |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.32400 |
| Flash Point | 212ºC |
| Exact Mass | 278.06100 |
| PSA | 60.98000 |
| LogP | 3.85210 |
| Index of Refraction | 1.567 |
| InChIKey | KWGBHIAGIZZACP-UHFFFAOYSA-N |
| SMILES | COc1ccccc1OS(=O)(=O)c1ccc(C)cc1 |
| HS Code | 2909499000 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-tosyloxyanisole |
| o-anisyl tosylate |
| 2-methoxyphenyl 4-methylbenzenesulfonate |
| 2-methoxyphenyl tosylate |
| 2-Chlorprop-1-yltosylat |
| 2-chloropropan-1-ol tosylate |
| 2-chloropropyl toluene-4-sulphonate |
| toluene-4-sulfonic acid 2-methoxy-phenyl ester |
| ortho-methoxyphenyl tosylate |
| toluene-4-sulfonic acid 2-chloro-propyl ester |