2,4,6-Cycloheptatrien-1-one,2-hydroxy-5-(3- methyl-2-butenyl)-4-(1-methylethyl)- structure
|
Common Name | 2,4,6-Cycloheptatrien-1-one,2-hydroxy-5-(3- methyl-2-butenyl)-4-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 4431-03-2 | Molecular Weight | 232.31800 | |
| Density | 1.036g/cm3 | Boiling Point | 368.2ºC at 760 mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | 2-hydroxy-5-(3-methylbut-2-enyl)-6-propan-2-ylcyclohepta-2,4,6-trien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036g/cm3 |
|---|---|
| Boiling Point | 368.2ºC at 760 mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.31800 |
| Flash Point | 157.1ºC |
| Exact Mass | 232.14600 |
| PSA | 37.30000 |
| LogP | 3.38450 |
| Index of Refraction | 1.535 |
| InChIKey | MNMNTZYOZZLKSV-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1ccc(O)c(=O)cc1C(C)C |
| HS Code | 2914400090 |
|---|
|
~%
2,4,6-Cyclohept... CAS#:4431-03-2 |
| Literature: Kitahara; Funamizu Bulletin of the Chemical Society of Japan, 1958 , vol. 31, p. 782 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| HMS3091E24 |
| Nootkatin |