5-(3-hydroxy-4-methoxyphenyl)-2-methoxyphenol structure
|
Common Name | 5-(3-hydroxy-4-methoxyphenyl)-2-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 4433-09-4 | Molecular Weight | 246.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-hydroxy-4-methoxyphenyl)-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O4 |
|---|---|
| Molecular Weight | 246.25900 |
| Exact Mass | 246.08900 |
| PSA | 58.92000 |
| LogP | 2.78200 |
| InChIKey | FCDFDUAKFSLDQD-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(OC)c(O)c2)cc1O |
| HS Code | 2922299090 |
|---|
|
~%
5-(3-hydroxy-4-... CAS#:4433-09-4 |
| Literature: Fichter; Dietrich Helvetica Chimica Acta, 1924 , vol. 7, p. 135 |
|
~%
5-(3-hydroxy-4-... CAS#:4433-09-4 |
| Literature: Musso,H.; Pietsch,H. Chemische Berichte, 1967 , vol. 100, p. 2854 - 2869 |
|
~%
5-(3-hydroxy-4-... CAS#:4433-09-4 |
| Literature: Musso,H.; Pietsch,H. Chemische Berichte, 1967 , vol. 100, p. 2854 - 2869 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4.4'-Dioxy-3.3'-dimethoxy-diphenyl |
| 4,4'-Dihydroxy-3,3'-dimethoxybiphenyl |
| 3,3'-Dimethoxy-4,4'-dihydroxy-diphenyl |
| 3,3'-dimethoxybiphenyl-4,4'-diol |
| 3,3'-dimethoxy-4,4'-biphenol |
| 4,4'-Biguaiacol |