Chrysoidine R structure
|
Common Name | Chrysoidine R | ||
|---|---|---|---|---|
| CAS Number | 4438-16-8 | Molecular Weight | 262.73800 | |
| Density | 1.21 g/cm3 | Boiling Point | 448.5ºC at 760 mmHg | |
| Molecular Formula | C13H15ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
Use of Chrysoidine RChrysoidine R is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 4-methyl-6-phenyldiazenylbenzene-1,3-diamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Chrysoidine R is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.21 g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760 mmHg |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.73800 |
| Flash Point | 225.1ºC |
| Exact Mass | 262.09900 |
| PSA | 76.76000 |
| LogP | 5.53920 |
| Index of Refraction | 1.636 |
| InChIKey | SYGRIMFNUFCHJC-UHFFFAOYSA-N |
| SMILES | Cc1cc(N=Nc2ccccc2)c(N)cc1N.Cl |
| Calcozine Orange RS |
| Chrysoidine RRS |
| Chrysoidine RN |
| Methylchrysoidine |
| Chrysoidine 3RN |
| Chrysoidine 3R |
| Chrysoidine RS |
| Pure Chrysoidine RD |
| EINECS 224-654-3 |
| Chrysoidine R |
| MFCD00051008 |
| Chrysoidine RPL |