Naphthol AS-KN structure
|
Common Name | Naphthol AS-KN | ||
|---|---|---|---|---|
| CAS Number | 4444-48-8 | Molecular Weight | 353.4 | |
| Density | 1.402g/cm3 | Boiling Point | 524.1ºC at 760mmHg | |
| Molecular Formula | C23H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.8ºC | |
| Name | Naphthol AS-KN |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 524.1ºC at 760mmHg |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.4 |
| Flash Point | 270.8ºC |
| Exact Mass | 353.10519334 |
| PSA | 92.46000 |
| LogP | 5.61420 |
| Index of Refraction | 1.808 |
| InChIKey | GGFCTWROTWQWED-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)C3=C(C=C4C5=CC=CC=C5OC4=C3)O |
| HS Code | 2932999099 |
|---|
|
~%
Naphthol AS-KN CAS#:4444-48-8 |
| Literature: I.G. Farbenind Patent: DE607381 , 1932 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 21, p. 275 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxy-2',5'-dimethoxydibenzofuran-3-carboxanilide |
| Naphtanilide BT |
| Naphthanil DB |
| Naphthol AS-DB |
| 2-hydroxy-N-naphthyl-3-dibenzofuran-3-carboxamide |
| Naphthol AS-BT |
| C.I. Azoic Coupling Component 16 |