2-amino-5-phenylbenzoic acid
2-amino-5-phenylbenzoic acid structure
|
Common Name | 2-amino-5-phenylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4445-40-3 | Molecular Weight | 213.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-5-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NO2 |
|---|---|
| Molecular Weight | 213.23200 |
| Exact Mass | 213.07900 |
| PSA | 63.32000 |
| LogP | 3.21520 |
| InChIKey | MUJQJJYAAYPRHQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2ccccc2)cc1C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922499990 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 1 | |
CAS#:5794-88-7
CAS#:98-80-6
CAS#:109496-98-2
CAS#:108620-13-9
CAS#:63040-30-2
CAS#:5152-76-1
CAS#:20780-76-1
CAS#:60313-92-0
CAS#:540-37-4
CAS#:206190-28-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-5-phenyl-benzoic acid |
| 4-aminobiphenyl-3-carboxylic acid |
| 5-phenylanthranilic acid |
| 4-Amino-biphenyl-3-carbonsaeure |
| 4-amino-3-carboxybiphenyl |
| F9995-0198 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-amino-5-phenylbenzoic acid? |
| A: InChIKey of 2-amino-5-phenylbenzoic acid is MUJQJJYAAYPRHQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-amino-5-phenylbenzoic acid? |
| A: CAS number of 2-amino-5-phenylbenzoic acid is 4445-40-3. |
| Q: What is the polar surface area (PSA) of 2-amino-5-phenylbenzoic acid? |
| A: Polar surface area (PSA) of 2-amino-5-phenylbenzoic acid is 63.32000. |
| Q: What is the SMILES notation of 2-amino-5-phenylbenzoic acid? |
| A: SMILES notation of 2-amino-5-phenylbenzoic acid is Nc1ccc(-c2ccccc2)cc1C(=O)O. |
| Q: What is the Chinese name of 4445-40-3? |
| A: Chinese name of 4445-40-3 is 4445-40-3. |
| Q: What is the English name of 2-amino-5-phenylbenzoic acid? |
| A: The English name of 2-amino-5-phenylbenzoic acid is 2-amino-5-phenylbenzoic acid. |
| Q: What are the downstream products of 2-amino-5-phenylbenzoic acid? |
| A: Related downstream products(CAS) of 2-amino-5-phenylbenzoic acid: 206190-28-5. |
| Q: What are the upstream materials of 2-amino-5-phenylbenzoic acid? |
| A: Related upstream materials(CAS) of 2-amino-5-phenylbenzoic acid: 5794-88-7;98-80-6;109496-98-2;108620-13-9;63040-30-2;5152-76-1;20780-76-1;60313-92-0;540-37-4. |
| Q: What is the LogP of 2-amino-5-phenylbenzoic acid? |
| A: LogP of 2-amino-5-phenylbenzoic acid is 3.21520. |
| Q: What is the molecular formula of 2-amino-5-phenylbenzoic acid? |
| A: Molecular formula of 2-amino-5-phenylbenzoic acid is C13H11NO2. |