2-amino-5-phenylbenzoic acid structure
|
Common Name | 2-amino-5-phenylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4445-40-3 | Molecular Weight | 213.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO2 |
|---|---|
| Molecular Weight | 213.23200 |
| Exact Mass | 213.07900 |
| PSA | 63.32000 |
| LogP | 3.21520 |
| InChIKey | MUJQJJYAAYPRHQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2ccccc2)cc1C(=O)O |
| HS Code | 2922499990 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-5-phenyl-benzoic acid |
| 4-aminobiphenyl-3-carboxylic acid |
| 5-phenylanthranilic acid |
| 4-Amino-biphenyl-3-carbonsaeure |
| 4-amino-3-carboxybiphenyl |
| F9995-0198 |