2,3-Dimethyl-6-nitro-2H-indazole structure
|
Common Name | 2,3-Dimethyl-6-nitro-2H-indazole | ||
|---|---|---|---|---|
| CAS Number | 444731-73-1 | Molecular Weight | 191.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 377.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8±22.3 °C | |
| Name | 2,3-Dimethyl-6-Nitro-2H-Indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.0±22.0 °C at 760 mmHg |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.187 |
| Flash Point | 181.8±22.3 °C |
| Exact Mass | 191.069473 |
| PSA | 63.64000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | JHGRUPGVUMAQQU-UHFFFAOYSA-N |
| SMILES | Cc1c2ccc([N+](=O)[O-])cc2nn1C |
| HS Code | 2933990090 |
|---|
|
~79%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 24, # 4 p. 1108 - 1110 |
|
~63%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: US2008/293691 A1, ; Page/Page column 8 ; |
|
~71%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: WO2007/64753 A2, ; Page/Page column 24-25 ; |
|
~71%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: WO2007/64753 A2, ; Page/Page column 25-26 ; |
|
~70%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: US2008/293691 A1, ; Page/Page column 8 ; |
|
~49%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: WO2009/62658 A1, ; Page/Page column 34; 1/10 ; WO 2009/062658 A1 |
|
~%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: Tetrahedron Letters, , vol. 54, # 13 p. 1661 - 1663 |
|
~63%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: WO2007/64753 A2, ; Page/Page column 25 ; |
|
~%
2,3-Dimethyl-6-... CAS#:444731-73-1 |
| Literature: Letters in Organic Chemistry, , vol. 9, # 4 p. 276 - 279 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Dimethyl-6-nitro-2H-indazole |
| 2H-Indazole, 2,3-dimethyl-6-nitro- |
| 2,3-dimethyl-6-nitroindazole |