5-[[4-[bis(2-chloroethyl)amino]phenyl]diazenyl]pyrimidine-2,4,6-triamine structure
|
Common Name | 5-[[4-[bis(2-chloroethyl)amino]phenyl]diazenyl]pyrimidine-2,4,6-triamine | ||
|---|---|---|---|---|
| CAS Number | 4449-93-8 | Molecular Weight | 369.25200 | |
| Density | 1.54g/cm3 | Boiling Point | 697.8ºC at 760 mmHg | |
| Molecular Formula | C14H18Cl2N8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 375.8ºC | |
| Name | 5-[[4-[bis(2-chloroethyl)amino]phenyl]diazenyl]pyrimidine-2,4,6-triamine |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 697.8ºC at 760 mmHg |
| Molecular Formula | C14H18Cl2N8 |
| Molecular Weight | 369.25200 |
| Flash Point | 375.8ºC |
| Exact Mass | 368.10300 |
| PSA | 131.80000 |
| LogP | 4.66620 |
| Index of Refraction | 1.704 |
| InChIKey | JHUUGDAWRSJWCY-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(N=Nc2ccc(N(CCCl)CCCl)cc2)c(N)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |