2-Fluoro-3,5-dinitrobenzoic acid structure
|
Common Name | 2-Fluoro-3,5-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 445-65-8 | Molecular Weight | 230.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3FN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Fluoro-3,5-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H3FN2O6 |
|---|---|
| Molecular Weight | 230.10700 |
| Exact Mass | 229.99800 |
| PSA | 128.94000 |
| LogP | 2.38670 |
| InChIKey | VJNLENXGKDEAMI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1F |
| HS Code | 2916399090 |
|---|
|
~84%
2-Fluoro-3,5-di... CAS#:445-65-8 |
| Literature: Petersen; Jensen Journal of Organic Chemistry, 2001 , vol. 66, # 19 p. 6268 - 6275 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2-fluoro-3,5-dimethoxy-,methyl ester |
| 2-fluoro-3,5-dinitro-benzoic acid |
| 2-fluoro-3,5-dimethoxybenzoic acid methyl ester |
| 2-Fluor-3,5-dinitro-benzoesaeure |