Anti-osteoporosis agent-7 structure
|
Common Name | Anti-osteoporosis agent-7 | ||
|---|---|---|---|---|
| CAS Number | 445254-59-1 | Molecular Weight | 368.25 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 514.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H19Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9±30.1 °C | |
Use of Anti-osteoporosis agent-7Anti-osteoporosis agent-7 (Compound 133) is a potential anti-osteoporosis agent showing high inhibition of osteoclast formation. |
| Name | WAY-325387 |
|---|---|
| Synonym | More Synonyms |
| Description | Anti-osteoporosis agent-7 (Compound 133) is a potential anti-osteoporosis agent showing high inhibition of osteoclast formation. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 514.4±50.0 °C at 760 mmHg |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.25 |
| Flash Point | 264.9±30.1 °C |
| Exact Mass | 367.074188 |
| LogP | 4.84 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | DQDYJTVTXVFLDC-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(COc2cc(Cl)ccc2Cl)o1)N1CCCCCC1 |
| 1-Azepanyl{5-[(2,5-dichlorophenoxy)methyl]-2-furyl}methanone |
| Methanone, [5-[(2,5-dichlorophenoxy)methyl]-2-furanyl](hexahydro-1H-azepin-1-yl)- |