N-(benzenesulfonamido)-2,2,2-trifluoro-ethanimidamide structure
|
Common Name | N-(benzenesulfonamido)-2,2,2-trifluoro-ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 4454-53-9 | Molecular Weight | 267.22800 | |
| Density | 1.53g/cm3 | Boiling Point | 328.5ºC at 760 mmHg | |
| Molecular Formula | C8H8F3N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.5ºC | |
| Name | N'-(benzenesulfonamido)-2,2,2-trifluoroethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 328.5ºC at 760 mmHg |
| Molecular Formula | C8H8F3N3O2S |
| Molecular Weight | 267.22800 |
| Flash Point | 152.5ºC |
| Exact Mass | 267.02900 |
| PSA | 90.43000 |
| LogP | 2.97140 |
| Index of Refraction | 1.544 |
| InChIKey | VYYBGPDFMAIJFS-UHFFFAOYSA-N |
| SMILES | NC(=NNS(=O)(=O)c1ccccc1)C(F)(F)F |
| HS Code | 2928000090 |
|---|
|
~%
N-(benzenesulfo... CAS#:4454-53-9 |
| Literature: Brown,H.C.; Pater,R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3739 - 3746 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N2-Benzolsulfonyl-trifluoracethydrazidin |